C25H40O3S — CID 162215366
butan-2-ylbenzene;1,4-di(butan-2-yl)benzene;hydron;methanesulfonate (PubChem CID 162215366) has the molecular formula C25H40O3S and a molecular weight of 420.66 g/mol. Its IUPAC name is butan-2-ylbenzene;1,4-di(butan-2-yl)benzene;hydron;methanesulfonate.
| Compound Name | butan-2-ylbenzene;1,4-di(butan-2-yl)benzene;hydron;methanesulfonate |
|---|---|
| PubChem CID | 162215366 |
| Molecular Formula | C25H40O3S |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | butan-2-ylbenzene;1,4-di(butan-2-yl)benzene;hydron;methanesulfonate |
| SMILES | CCC(C)c1ccc(C(C)CC)cc1.CCC(C)c1ccccc1.CS(=O)(=O)[O-].[H+] |
| InChI | InChI=1S/C14H22.C10H14.CH4O3S/c1-5-11(3)13-7-9-14(10-8-13)12(4)6-2;1-3-9(2)10-7-5-4-6-8-10;1-5(2,3)4/h7-12H,5-6H2,1-4H3;4-9H,3H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | LSNRLPKCLGZSRD-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|