C22H24N2O2S — CID 25357202
4-[(2R)-butan-2-yl]-N-[(R)-phenyl(pyridin-2-yl)methyl]benzenesulfonamide (PubChem CID 25357202) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 4-[(2R)-butan-2-yl]-N-[(R)-phenyl(pyridin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-[(2R)-butan-2-yl]-N-[(R)-phenyl(pyridin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25357202 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-[(2R)-butan-2-yl]-N-[(R)-phenyl(pyridin-2-yl)methyl]benzenesulfonamide |
| SMILES | CC[C@@H](C)c1ccc(S(=O)(=O)N[C@H](c2ccccc2)c2ccccn2)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-3-17(2)18-12-14-20(15-13-18)27(25,26)24-22(19-9-5-4-6-10-19)21-11-7-8-16-23-21/h4-17,22,24H,3H2,1-2H3/t17-,22-/m1/s1 |
| InChIKey | UTRKISLBLADDRM-VGOFRKELSA-N |
| XLogP | 4.66 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |