C23H26N2O2S — CID 25327185
2,3,4,5,6-pentamethyl-N-[(S)-phenyl(pyridin-2-yl)methyl]benzenesulfonamide (PubChem CID 25327185) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-[(S)-phenyl(pyridin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-[(S)-phenyl(pyridin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25327185 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-[(S)-phenyl(pyridin-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N[C@@H](c2ccccc2)c2ccccn2)c(C)c1C |
| InChI | InChI=1S/C23H26N2O2S/c1-15-16(2)18(4)23(19(5)17(15)3)28(26,27)25-22(20-11-7-6-8-12-20)21-13-9-10-14-24-21/h6-14,22,25H,1-5H3/t22-/m0/s1 |
| InChIKey | NKJDAPOTGQWNTK-QFIPXVFZSA-N |
| XLogP | 4.69 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |