C17H16N2O2S2 — CID 39794094
5-methyl-N-[(S)-phenyl(pyridin-2-yl)methyl]thiophene-2-sulfonamide (PubChem CID 39794094) has the molecular formula C17H16N2O2S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 5-methyl-N-[(S)-phenyl(pyridin-2-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[(S)-phenyl(pyridin-2-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 39794094 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 5-methyl-N-[(S)-phenyl(pyridin-2-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](c2ccccc2)c2ccccn2)s1 |
| InChI | InChI=1S/C17H16N2O2S2/c1-13-10-11-16(22-13)23(20,21)19-17(14-7-3-2-4-8-14)15-9-5-6-12-18-15/h2-12,17,19H,1H3/t17-/m0/s1 |
| InChIKey | BFGJFBFNDKQKCV-KRWDZBQOSA-N |
| XLogP | 3.52 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |