C22H29NaO4S — CID 20717984
sodium 4-[4-(4-phenylhexan-2-yl)phenoxy]butane-1-sulfonate (PubChem CID 20717984) has the molecular formula C22H29NaO4S and a molecular weight of 412.53 g/mol. Its IUPAC name is sodium 4-[4-(4-phenylhexan-2-yl)phenoxy]butane-1-sulfonate.
| Compound Name | sodium 4-[4-(4-phenylhexan-2-yl)phenoxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 20717984 |
| Molecular Formula | C22H29NaO4S |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | sodium 4-[4-(4-phenylhexan-2-yl)phenoxy]butane-1-sulfonate |
| SMILES | CCC(CC(C)c1ccc(OCCCCS(=O)(=O)[O-])cc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C22H30O4S.Na/c1-3-19(21-9-5-4-6-10-21)17-18(2)20-11-13-22(14-12-20)26-15-7-8-16-27(23,24)25;/h4-6,9-14,18-19H,3,7-8,15-17H2,1-2H3,(H,23,24,25);/q;+1/p-1 |
| InChIKey | XMLHPOKVVSVWLD-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|