C27H41NO — CID 58969107
3-[4-[5-(4-butan-2-ylphenyl)hexan-3-yl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 58969107) has the molecular formula C27H41NO and a molecular weight of 395.63 g/mol. Its IUPAC name is 3-[4-[5-(4-butan-2-ylphenyl)hexan-3-yl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-[5-(4-butan-2-ylphenyl)hexan-3-yl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 58969107 |
| Molecular Formula | C27H41NO |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.32 |
| IUPAC Name | 3-[4-[5-(4-butan-2-ylphenyl)hexan-3-yl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CCC(C)c1ccc(C(C)CC(CC)c2ccc(OCCCN(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H41NO/c1-7-21(3)24-10-12-25(13-11-24)22(4)20-23(8-2)26-14-16-27(17-15-26)29-19-9-18-28(5)6/h10-17,21-23H,7-9,18-20H2,1-6H3 |
| InChIKey | MGMFYSMVCHHKHV-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|