C16H26O — CID 70947393
1-butan-2-yl-4-(3,3-dimethylbutoxy)benzene (PubChem CID 70947393) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 1-butan-2-yl-4-(3,3-dimethylbutoxy)benzene.
| Compound Name | 1-butan-2-yl-4-(3,3-dimethylbutoxy)benzene |
|---|---|
| PubChem CID | 70947393 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 1-butan-2-yl-4-(3,3-dimethylbutoxy)benzene |
| SMILES | CCC(C)c1ccc(OCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26O/c1-6-13(2)14-7-9-15(10-8-14)17-12-11-16(3,4)5/h7-10,13H,6,11-12H2,1-5H3 |
| InChIKey | AAPKSFBLXRXUHQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |