C15H24OS — CID 107669469
3-(4-butan-2-ylphenoxy)-2,2-dimethylpropane-1-thiol (PubChem CID 107669469) has the molecular formula C15H24OS and a molecular weight of 252.42 g/mol. Its IUPAC name is 3-(4-butan-2-ylphenoxy)-2,2-dimethylpropane-1-thiol.
| Compound Name | 3-(4-butan-2-ylphenoxy)-2,2-dimethylpropane-1-thiol |
|---|---|
| PubChem CID | 107669469 |
| Molecular Formula | C15H24OS |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3-(4-butan-2-ylphenoxy)-2,2-dimethylpropane-1-thiol |
| SMILES | CCC(C)c1ccc(OCC(C)(C)CS)cc1 |
| InChI | InChI=1S/C15H24OS/c1-5-12(2)13-6-8-14(9-7-13)16-10-15(3,4)11-17/h6-9,12,17H,5,10-11H2,1-4H3 |
| InChIKey | YNOQFUKFLDKTSD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|