C16H26O — CID 159159765
1-butan-2-yl-4-(3,3-dimethylbutan-2-yloxy)benzene (PubChem CID 159159765) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 1-butan-2-yl-4-(3,3-dimethylbutan-2-yloxy)benzene.
| Compound Name | 1-butan-2-yl-4-(3,3-dimethylbutan-2-yloxy)benzene |
|---|---|
| PubChem CID | 159159765 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 1-butan-2-yl-4-(3,3-dimethylbutan-2-yloxy)benzene |
| SMILES | CCC(C)c1ccc(OC(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26O/c1-7-12(2)14-8-10-15(11-9-14)17-13(3)16(4,5)6/h8-13H,7H2,1-6H3 |
| InChIKey | WWLIMLKUPRNOHP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |