C17H29NO2 — CID 107669189
4-(4-butan-2-ylphenoxy)-2-methyl-2-(methylamino)pentan-1-ol (PubChem CID 107669189) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 4-(4-butan-2-ylphenoxy)-2-methyl-2-(methylamino)pentan-1-ol.
| Compound Name | 4-(4-butan-2-ylphenoxy)-2-methyl-2-(methylamino)pentan-1-ol |
|---|---|
| PubChem CID | 107669189 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 4-(4-butan-2-ylphenoxy)-2-methyl-2-(methylamino)pentan-1-ol |
| SMILES | CCC(C)c1ccc(OC(C)CC(C)(CO)NC)cc1 |
| InChI | InChI=1S/C17H29NO2/c1-6-13(2)15-7-9-16(10-8-15)20-14(3)11-17(4,12-19)18-5/h7-10,13-14,18-19H,6,11-12H2,1-5H3 |
| InChIKey | RSXXDSKKRPOIKA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |