C15H25NO2 — CID 64803067
2-methyl-2-(methylamino)-4-(4-propan-2-ylphenoxy)butan-1-ol (PubChem CID 64803067) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-4-(4-propan-2-ylphenoxy)butan-1-ol.
| Compound Name | 2-methyl-2-(methylamino)-4-(4-propan-2-ylphenoxy)butan-1-ol |
|---|---|
| PubChem CID | 64803067 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-methyl-2-(methylamino)-4-(4-propan-2-ylphenoxy)butan-1-ol |
| SMILES | CNC(C)(CO)CCOc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C15H25NO2/c1-12(2)13-5-7-14(8-6-13)18-10-9-15(3,11-17)16-4/h5-8,12,16-17H,9-11H2,1-4H3 |
| InChIKey | NNKXRPHEXXSUKP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |