C14H22FNO2 — CID 64803932
2-(ethylamino)-4-(4-fluorophenoxy)-2-methylpentan-1-ol (PubChem CID 64803932) has the molecular formula C14H22FNO2 and a molecular weight of 255.33 g/mol. Its IUPAC name is 2-(ethylamino)-4-(4-fluorophenoxy)-2-methylpentan-1-ol.
| Compound Name | 2-(ethylamino)-4-(4-fluorophenoxy)-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 64803932 |
| Molecular Formula | C14H22FNO2 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-(ethylamino)-4-(4-fluorophenoxy)-2-methylpentan-1-ol |
| SMILES | CCNC(C)(CO)CC(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C14H22FNO2/c1-4-16-14(3,10-17)9-11(2)18-13-7-5-12(15)6-8-13/h5-8,11,16-17H,4,9-10H2,1-3H3 |
| InChIKey | IZSYEYUSCYWELJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |