C16H25NO3 — CID 107667958
methyl 2-amino-4-(4-butan-2-ylphenoxy)-2-methylbutanoate (PubChem CID 107667958) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is methyl 2-amino-4-(4-butan-2-ylphenoxy)-2-methylbutanoate.
| Compound Name | methyl 2-amino-4-(4-butan-2-ylphenoxy)-2-methylbutanoate |
|---|---|
| PubChem CID | 107667958 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | methyl 2-amino-4-(4-butan-2-ylphenoxy)-2-methylbutanoate |
| SMILES | CCC(C)c1ccc(OCCC(C)(N)C(=O)OC)cc1 |
| InChI | InChI=1S/C16H25NO3/c1-5-12(2)13-6-8-14(9-7-13)20-11-10-16(3,17)15(18)19-4/h6-9,12H,5,10-11,17H2,1-4H3 |
| InChIKey | MFBPOZGPGPTVBU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |