C19H24O — CID 134214893
1-methoxy-4-(4-phenylhexan-2-yl)benzene (PubChem CID 134214893) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-methoxy-4-(4-phenylhexan-2-yl)benzene.
| Compound Name | 1-methoxy-4-(4-phenylhexan-2-yl)benzene |
|---|---|
| PubChem CID | 134214893 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-methoxy-4-(4-phenylhexan-2-yl)benzene |
| SMILES | CCC(CC(C)c1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H24O/c1-4-16(18-8-6-5-7-9-18)14-15(2)17-10-12-19(20-3)13-11-17/h5-13,15-16H,4,14H2,1-3H3 |
| InChIKey | XBUMJLIDLJQABW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |