C19H24O2 — CID 20681979
4-[5-(4-methoxyphenyl)hexan-3-yl]phenol (PubChem CID 20681979) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-[5-(4-methoxyphenyl)hexan-3-yl]phenol.
| Compound Name | 4-[5-(4-methoxyphenyl)hexan-3-yl]phenol |
|---|---|
| PubChem CID | 20681979 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 4-[5-(4-methoxyphenyl)hexan-3-yl]phenol |
| SMILES | CCC(CC(C)c1ccc(OC)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H24O2/c1-4-15(17-5-9-18(20)10-6-17)13-14(2)16-7-11-19(21-3)12-8-16/h5-12,14-15,20H,4,13H2,1-3H3 |
| InChIKey | HVZLVEKFMYULCK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |