C22H30O3 — CID 23556512
4-[4-[4-(1-ethoxyethoxy)phenyl]hexan-2-yl]phenol (PubChem CID 23556512) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 4-[4-[4-(1-ethoxyethoxy)phenyl]hexan-2-yl]phenol.
| Compound Name | 4-[4-[4-(1-ethoxyethoxy)phenyl]hexan-2-yl]phenol |
|---|---|
| PubChem CID | 23556512 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 4-[4-[4-(1-ethoxyethoxy)phenyl]hexan-2-yl]phenol |
| SMILES | CCOC(C)Oc1ccc(C(CC)CC(C)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H30O3/c1-5-18(15-16(3)19-7-11-21(23)12-8-19)20-9-13-22(14-10-20)25-17(4)24-6-2/h7-14,16-18,23H,5-6,15H2,1-4H3 |
| InChIKey | QOIYXSJPWDSMNS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|