C31H34F4O8S — CID 177097770
4-[6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)heptanoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 177097770) has the molecular formula C31H34F4O8S and a molecular weight of 642.66 g/mol. Its IUPAC name is 4-[6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)heptanoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)heptanoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 177097770 |
| Molecular Formula | C31H34F4O8S |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | 4-[6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)heptanoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCOC(C)Oc1ccc(C(C)CC(CC(CC)C(=O)Oc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C31H34F4O8S/c1-5-19(31(37)43-29-25(32)27(34)30(44(38,39)40)28(35)26(29)33)16-22(21-7-11-23(36)12-8-21)15-17(3)20-9-13-24(14-10-20)42-18(4)41-6-2/h7-14,17-19,22,36H,5-6,15-16H2,1-4H3,(H,38,39,40) |
| InChIKey | CTIGCTLVVFEOEX-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|