C53H66O7 — CID 22088342
tert-butyl [4-[5-[4-(1-ethoxyethoxy)phenyl]-9-(4-ethylphenyl)-7,11-bis(4-hydroxyphenyl)dodecan-3-yl]phenyl] carbonate (PubChem CID 22088342) has the molecular formula C53H66O7 and a molecular weight of 815.10 g/mol. Its IUPAC name is tert-butyl [4-[5-[4-(1-ethoxyethoxy)phenyl]-9-(4-ethylphenyl)-7,11-bis(4-hydroxyphenyl)dodecan-3-yl]phenyl] carbonate.
| Compound Name | tert-butyl [4-[5-[4-(1-ethoxyethoxy)phenyl]-9-(4-ethylphenyl)-7,11-bis(4-hydroxyphenyl)dodecan-3-yl]phenyl] carbonate |
|---|---|
| PubChem CID | 22088342 |
| Molecular Formula | C53H66O7 |
| Molecular Weight | 815.10 g/mol |
| Exact Mass | 814.48 |
| IUPAC Name | tert-butyl [4-[5-[4-(1-ethoxyethoxy)phenyl]-9-(4-ethylphenyl)-7,11-bis(4-hydroxyphenyl)dodecan-3-yl]phenyl] carbonate |
| SMILES | CCOC(C)Oc1ccc(C(CC(CC)c2ccc(OC(=O)OC(C)(C)C)cc2)CC(CC(CC(C)c2ccc(O)cc2)c2ccc(CC)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C53H66O7/c1-9-38-12-14-42(15-13-38)45(32-36(4)40-16-24-48(54)25-17-40)34-47(43-18-26-49(55)27-19-43)35-46(44-22-28-50(29-23-44)58-37(5)57-11-3)33-39(10-2)41-20-30-51(31-21-41)59-52(56)60-53(6,7)8/h12-31,36-37,39,45-47,54-55H,9-11,32-35H2,1-8H3 |
| InChIKey | WTVBOVYYQVBUDU-UHFFFAOYSA-N |
| XLogP | 13.94 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.10 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|