C36H47NO6 — CID 20702512
2-[4-[4-[4-(1-ethoxyethoxy)phenyl]-6-(4-hydroxyphenyl)octan-2-yl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 20702512) has the molecular formula C36H47NO6 and a molecular weight of 589.77 g/mol. Its IUPAC name is 2-[4-[4-[4-(1-ethoxyethoxy)phenyl]-6-(4-hydroxyphenyl)octan-2-yl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[4-[4-(1-ethoxyethoxy)phenyl]-6-(4-hydroxyphenyl)octan-2-yl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 20702512 |
| Molecular Formula | C36H47NO6 |
| Molecular Weight | 589.77 g/mol |
| Exact Mass | 589.34 |
| IUPAC Name | 2-[4-[4-[4-(1-ethoxyethoxy)phenyl]-6-(4-hydroxyphenyl)octan-2-yl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | CCOC(C)Oc1ccc(C(CC(C)c2ccc(OCC(=O)N3CCOCC3)cc2)CC(CC)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C36H47NO6/c1-5-28(30-7-13-33(38)14-8-30)24-32(31-11-17-35(18-12-31)43-27(4)41-6-2)23-26(3)29-9-15-34(16-10-29)42-25-36(39)37-19-21-40-22-20-37/h7-18,26-28,32,38H,5-6,19-25H2,1-4H3 |
| InChIKey | BJOJNOBHKVBCBE-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.77 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|