C25H36O4 — CID 145290862
2-[1-[4-[5-(4-propan-2-yloxyphenyl)hexan-3-yl]phenoxy]ethoxy]ethanol (PubChem CID 145290862) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-[1-[4-[5-(4-propan-2-yloxyphenyl)hexan-3-yl]phenoxy]ethoxy]ethanol.
| Compound Name | 2-[1-[4-[5-(4-propan-2-yloxyphenyl)hexan-3-yl]phenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 145290862 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-[1-[4-[5-(4-propan-2-yloxyphenyl)hexan-3-yl]phenoxy]ethoxy]ethanol |
| SMILES | CCC(CC(C)c1ccc(OC(C)C)cc1)c1ccc(OC(C)OCCO)cc1 |
| InChI | InChI=1S/C25H36O4/c1-6-21(17-19(4)22-7-11-24(12-8-22)28-18(2)3)23-9-13-25(14-10-23)29-20(5)27-16-15-26/h7-14,18-21,26H,6,15-17H2,1-5H3 |
| InChIKey | AQKOHULVXMJGDW-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|