C32H40O8S — CID 177097774
4-[6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)-2-methylheptanoyl]oxybenzenesulfonic acid (PubChem CID 177097774) has the molecular formula C32H40O8S and a molecular weight of 584.73 g/mol. Its IUPAC name is 4-[6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)-2-methylheptanoyl]oxybenzenesulfonic acid.
| Compound Name | 4-[6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)-2-methylheptanoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 177097774 |
| Molecular Formula | C32H40O8S |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 4-[6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)-2-methylheptanoyl]oxybenzenesulfonic acid |
| SMILES | CCOC(C)Oc1ccc(C(C)CC(CC(C)(CC)C(=O)Oc2ccc(S(=O)(=O)O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C32H40O8S/c1-6-32(5,31(34)40-29-16-18-30(19-17-29)41(35,36)37)21-26(25-8-12-27(33)13-9-25)20-22(3)24-10-14-28(15-11-24)39-23(4)38-7-2/h8-19,22-23,26,33H,6-7,20-21H2,1-5H3,(H,35,36,37) |
| InChIKey | VITLYJCNKATQMO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|