C32H44O7 — CID 20675707
(4-methyl-2-oxooxan-4-yl) 6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)-2-methylheptanoate (PubChem CID 20675707) has the molecular formula C32H44O7 and a molecular weight of 540.70 g/mol. Its IUPAC name is (4-methyl-2-oxooxan-4-yl) 6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)-2-methylheptanoate.
| Compound Name | (4-methyl-2-oxooxan-4-yl) 6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)-2-methylheptanoate |
|---|---|
| PubChem CID | 20675707 |
| Molecular Formula | C32H44O7 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (4-methyl-2-oxooxan-4-yl) 6-[4-(1-ethoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)-2-methylheptanoate |
| SMILES | CCOC(C)Oc1ccc(C(C)CC(CC(C)(CC)C(=O)OC2(C)CCOC(=O)C2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C32H44O7/c1-7-31(5,30(35)39-32(6)17-18-37-29(34)21-32)20-26(25-9-13-27(33)14-10-25)19-22(3)24-11-15-28(16-12-24)38-23(4)36-8-2/h9-16,22-23,26,33H,7-8,17-21H2,1-6H3 |
| InChIKey | RFNMECOGSBQUBY-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|