C19H32O6 — CID 20675711
5-O-tert-butyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate (PubChem CID 20675711) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 20675711 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 5-O-tert-butyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate |
| SMILES | CCC(C)(CC(C)C(=O)OC(C)(C)C)C(=O)OC1(C)CCOC(=O)C1 |
| InChI | InChI=1S/C19H32O6/c1-8-18(6,11-13(2)15(21)24-17(3,4)5)16(22)25-19(7)9-10-23-14(20)12-19/h13H,8-12H2,1-7H3 |
| InChIKey | GIBVHOYSFBVZPK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|