About (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate
(3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate (PubChem CID 129121603) has the molecular formula C10H15IO4
and a molecular weight of 326.13 g/mol. Its IUPAC name is (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate.
Molecular Properties
| Compound Name | (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate |
| PubChem CID | 129121603 |
| Molecular Formula | C10H15IO4 |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1(C)COC(=O)C1 |
| InChI | InChI=1S/C10H15IO4/c1-4-10(3,11)8(13)15-9(2)5-7(12)14-6-9/h4-6H2,1-3H3 |
| InChIKey | GMXMMZKQJJIUIG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate?
The IUPAC name of (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate (CID 129121603) is (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate.
What is the SMILES notation for (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate?
The canonical SMILES for (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate is CCC(C)(I)C(=O)OC1(C)COC(=O)C1.
What is the InChIKey of (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate?
The InChIKey is GMXMMZKQJJIUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15IO4/c1-4-10(3,11)8(13)15-9(2)5-7(12)14-6-9/h4-6H2,1-3H3.
What are the key properties of (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate?
(3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate has a molecular weight of 326.13 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate is sourced from PubChem (CID 129121603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).