C10H15IO4 — CID 129121603
(3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate (PubChem CID 129121603) has the molecular formula C10H15IO4 and a molecular weight of 326.13 g/mol. Its IUPAC name is (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate.
| Compound Name | (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 129121603 |
| Molecular Formula | C10H15IO4 |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | (3-methyl-5-oxooxolan-3-yl) 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1(C)COC(=O)C1 |
| InChI | InChI=1S/C10H15IO4/c1-4-10(3,11)8(13)15-9(2)5-7(12)14-6-9/h4-6H2,1-3H3 |
| InChIKey | GMXMMZKQJJIUIG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|