About (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate
(4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate (PubChem CID 129121892) has the molecular formula C10H15IO5
and a molecular weight of 342.13 g/mol. Its IUPAC name is (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate.
Molecular Properties
| Compound Name | (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate |
| PubChem CID | 129121892 |
| Molecular Formula | C10H15IO5 |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OCC1(C)COC(=O)O1 |
| InChI | InChI=1S/C10H15IO5/c1-4-10(3,11)7(12)14-5-9(2)6-15-8(13)16-9/h4-6H2,1-3H3 |
| InChIKey | HNKPCJOEOADGJZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate?
The IUPAC name of (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate (CID 129121892) is (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate.
What is the SMILES notation for (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate?
The canonical SMILES for (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate is CCC(C)(I)C(=O)OCC1(C)COC(=O)O1.
What is the InChIKey of (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate?
The InChIKey is HNKPCJOEOADGJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15IO5/c1-4-10(3,11)7(12)14-5-9(2)6-15-8(13)16-9/h4-6H2,1-3H3.
What are the key properties of (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate?
(4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate has a molecular weight of 342.13 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2-oxo-1,3-dioxolan-4-yl)methyl 2-iodo-2-methylbutanoate is sourced from PubChem (CID 129121892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).