C8H12O4 — CID 139625615
4-methyl-4-(prop-1-enoxymethyl)-1,3-dioxolan-2-one (PubChem CID 139625615) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 4-methyl-4-(prop-1-enoxymethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-methyl-4-(prop-1-enoxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 139625615 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4-methyl-4-(prop-1-enoxymethyl)-1,3-dioxolan-2-one |
| SMILES | CC=COCC1(C)COC(=O)O1 |
| InChI | InChI=1S/C8H12O4/c1-3-4-10-5-8(2)6-11-7(9)12-8/h3-4H,5-6H2,1-2H3 |
| InChIKey | VKLZOOMBCBAHRI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|