C11H20O3 — CID 59942377
4,4-ditert-butyl-1,3-dioxolan-2-one (PubChem CID 59942377) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 4,4-ditert-butyl-1,3-dioxolan-2-one.
| Compound Name | 4,4-ditert-butyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 59942377 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 4,4-ditert-butyl-1,3-dioxolan-2-one |
| SMILES | CC(C)(C)C1(C(C)(C)C)COC(=O)O1 |
| InChI | InChI=1S/C11H20O3/c1-9(2,3)11(10(4,5)6)7-13-8(12)14-11/h7H2,1-6H3 |
| InChIKey | DPBRUZVJZWQPFF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |