C11H20O3 — CID 58446547
(4S,5R)-4,5-ditert-butyl-1,3-dioxolan-2-one (PubChem CID 58446547) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (4S,5R)-4,5-ditert-butyl-1,3-dioxolan-2-one.
| Compound Name | (4S,5R)-4,5-ditert-butyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 58446547 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (4S,5R)-4,5-ditert-butyl-1,3-dioxolan-2-one |
| SMILES | CC(C)(C)[C@@H]1OC(=O)O[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C11H20O3/c1-10(2,3)7-8(11(4,5)6)14-9(12)13-7/h7-8H,1-6H3/t7-,8+ |
| InChIKey | BFWGKBFIXSPCQH-OCAPTIKFSA-N |
| XLogP | 2.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |