methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid

C8H14O5 — CID 160909748

IUPACmethane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid
SMILESC.CC1(CC(=O)O)CCOC(=O)O1
InChIInChI=1S/C7H10O5.CH4/c1-7(4-5(8)9)2-3-11-6(10)12-7;/h2-4H2,1H3,(H,8,9);1H4
InChIKeySQPQFHOJOBPYKU-UHFFFAOYSA-N
MW190.19 g/mol
LogP1.41
Rot. Bonds2

About methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid

methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid (PubChem CID 160909748) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid.

Molecular Properties

Compound Namemethane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid
PubChem CID160909748
Molecular FormulaC8H14O5
Molecular Weight190.19 g/mol
Exact Mass190.08
IUPAC Namemethane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid
SMILESC.CC1(CC(=O)O)CCOC(=O)O1
InChIInChI=1S/C7H10O5.CH4/c1-7(4-5(8)9)2-3-11-6(10)12-7;/h2-4H2,1H3,(H,8,9);1H4
InChIKeySQPQFHOJOBPYKU-UHFFFAOYSA-N
XLogP1.41
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.19
LogP ≤ 51.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid?
The IUPAC name of methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid (CID 160909748) is methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid.
What is the SMILES notation for methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid?
The canonical SMILES for methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid is C.CC1(CC(=O)O)CCOC(=O)O1.
What is the InChIKey of methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid?
The InChIKey is SQPQFHOJOBPYKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5.CH4/c1-7(4-5(8)9)2-3-11-6(10)12-7;/h2-4H2,1H3,(H,8,9);1H4.
What are the key properties of methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid?
methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid has a molecular weight of 190.19 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid is sourced from PubChem (CID 160909748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).