About methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid
methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid (PubChem CID 160909748) has the molecular formula C8H14O5
and a molecular weight of 190.19 g/mol. Its IUPAC name is methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid.
Analyze methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid?
The IUPAC name of methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid (CID 160909748) is methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid.
What is the SMILES notation for methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid?
The canonical SMILES for methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid is C.CC1(CC(=O)O)CCOC(=O)O1.
What is the InChIKey of methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid?
The InChIKey is SQPQFHOJOBPYKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5.CH4/c1-7(4-5(8)9)2-3-11-6(10)12-7;/h2-4H2,1H3,(H,8,9);1H4.
What are the key properties of methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid?
methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid has a molecular weight of 190.19 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid is sourced from PubChem (CID 160909748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).