About oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate
oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate (PubChem CID 130226901) has the molecular formula C11H16O6
and a molecular weight of 244.24 g/mol. Its IUPAC name is oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate.
Analyze oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate?
The IUPAC name of oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate (CID 130226901) is oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate.
What is the SMILES notation for oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate?
The canonical SMILES for oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate is CC1(C(=O)OCC2CCOC2)CCOC(=O)O1.
What is the InChIKey of oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate?
The InChIKey is WTEHOIAANSOUMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O6/c1-11(3-5-15-10(13)17-11)9(12)16-7-8-2-4-14-6-8/h8H,2-7H2,1H3.
What are the key properties of oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate?
oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate has a molecular weight of 244.24 g/mol, XLogP of 0.88, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-ylmethyl 4-methyl-2-oxo-1,3-dioxane-4-carboxylate is sourced from PubChem (CID 130226901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).