C11H15NO5S2 — CID 61235023
oxolan-3-ylmethyl 2-(5-sulfamoylthiophen-2-yl)acetate (PubChem CID 61235023) has the molecular formula C11H15NO5S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is oxolan-3-ylmethyl 2-(5-sulfamoylthiophen-2-yl)acetate.
| Compound Name | oxolan-3-ylmethyl 2-(5-sulfamoylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 61235023 |
| Molecular Formula | C11H15NO5S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | oxolan-3-ylmethyl 2-(5-sulfamoylthiophen-2-yl)acetate |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)OCC2CCOC2)s1 |
| InChI | InChI=1S/C11H15NO5S2/c12-19(14,15)11-2-1-9(18-11)5-10(13)17-7-8-3-4-16-6-8/h1-2,8H,3-7H2,(H2,12,14,15) |
| InChIKey | KHTQCSJBEZWTLO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |