C14H22N2O3S2 — CID 65382614
N-(4,4-dimethylcyclohexyl)-2-(5-sulfamoylthiophen-2-yl)acetamide (PubChem CID 65382614) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-2-(5-sulfamoylthiophen-2-yl)acetamide.
| Compound Name | N-(4,4-dimethylcyclohexyl)-2-(5-sulfamoylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 65382614 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-2-(5-sulfamoylthiophen-2-yl)acetamide |
| SMILES | CC1(C)CCC(NC(=O)Cc2ccc(S(N)(=O)=O)s2)CC1 |
| InChI | InChI=1S/C14H22N2O3S2/c1-14(2)7-5-10(6-8-14)16-12(17)9-11-3-4-13(20-11)21(15,18)19/h3-4,10H,5-9H2,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | PBBIETHSIIODCT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |