C10H16N2O3S2 — CID 61068995
N,N-diethyl-2-(5-sulfamoylthiophen-2-yl)acetamide (PubChem CID 61068995) has the molecular formula C10H16N2O3S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N,N-diethyl-2-(5-sulfamoylthiophen-2-yl)acetamide.
| Compound Name | N,N-diethyl-2-(5-sulfamoylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 61068995 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N,N-diethyl-2-(5-sulfamoylthiophen-2-yl)acetamide |
| SMILES | CCN(CC)C(=O)Cc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C10H16N2O3S2/c1-3-12(4-2)9(13)7-8-5-6-10(16-8)17(11,14)15/h5-6H,3-4,7H2,1-2H3,(H2,11,14,15) |
| InChIKey | HISXDNSDEWPPQY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |