C8H11NO3S2 — CID 22147785
5-(3-oxobutyl)thiophene-2-sulfonamide (PubChem CID 22147785) has the molecular formula C8H11NO3S2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-(3-oxobutyl)thiophene-2-sulfonamide.
| Compound Name | 5-(3-oxobutyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22147785 |
| Molecular Formula | C8H11NO3S2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 5-(3-oxobutyl)thiophene-2-sulfonamide |
| SMILES | CC(=O)CCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C8H11NO3S2/c1-6(10)2-3-7-4-5-8(13-7)14(9,11)12/h4-5H,2-3H2,1H3,(H2,9,11,12) |
| InChIKey | QFEKQWOQQRLDDG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |