C7H9NO4S2 — CID 60753569
methyl 2-(5-sulfamoylthiophen-2-yl)acetate (PubChem CID 60753569) has the molecular formula C7H9NO4S2 and a molecular weight of 235.29 g/mol. Its IUPAC name is methyl 2-(5-sulfamoylthiophen-2-yl)acetate.
| Compound Name | methyl 2-(5-sulfamoylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 60753569 |
| Molecular Formula | C7H9NO4S2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | methyl 2-(5-sulfamoylthiophen-2-yl)acetate |
| SMILES | COC(=O)Cc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C7H9NO4S2/c1-12-6(9)4-5-2-3-7(13-5)14(8,10)11/h2-3H,4H2,1H3,(H2,8,10,11) |
| InChIKey | JYNOJTBMHBICQK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |