C11H18N2O4S2 — CID 64689300
N-(1-methoxybutan-2-yl)-2-(5-sulfamoylthiophen-2-yl)acetamide (PubChem CID 64689300) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(1-methoxybutan-2-yl)-2-(5-sulfamoylthiophen-2-yl)acetamide.
| Compound Name | N-(1-methoxybutan-2-yl)-2-(5-sulfamoylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 64689300 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-(1-methoxybutan-2-yl)-2-(5-sulfamoylthiophen-2-yl)acetamide |
| SMILES | CCC(COC)NC(=O)Cc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-3-8(7-17-2)13-10(14)6-9-4-5-11(18-9)19(12,15)16/h4-5,8H,3,6-7H2,1-2H3,(H,13,14)(H2,12,15,16) |
| InChIKey | WCSJQLAPJFZLRN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |