C12H20N2O3S2 — CID 64723560
N-(2,3-dimethylbutyl)-2-(5-sulfamoylthiophen-2-yl)acetamide (PubChem CID 64723560) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-2-(5-sulfamoylthiophen-2-yl)acetamide.
| Compound Name | N-(2,3-dimethylbutyl)-2-(5-sulfamoylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 64723560 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(2,3-dimethylbutyl)-2-(5-sulfamoylthiophen-2-yl)acetamide |
| SMILES | CC(C)C(C)CNC(=O)Cc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-8(2)9(3)7-14-11(15)6-10-4-5-12(18-10)19(13,16)17/h4-5,8-9H,6-7H2,1-3H3,(H,14,15)(H2,13,16,17) |
| InChIKey | IVSBMBHUVKPIAI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |