C10H14F2N2O4S2 — CID 103082307
N-[2-(2,2-difluoroethoxy)ethyl]-2-(5-sulfamoylthiophen-2-yl)acetamide (PubChem CID 103082307) has the molecular formula C10H14F2N2O4S2 and a molecular weight of 328.36 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-2-(5-sulfamoylthiophen-2-yl)acetamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-(5-sulfamoylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 103082307 |
| Molecular Formula | C10H14F2N2O4S2 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-(5-sulfamoylthiophen-2-yl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)NCCOCC(F)F)s1 |
| InChI | InChI=1S/C10H14F2N2O4S2/c11-8(12)6-18-4-3-14-9(15)5-7-1-2-10(19-7)20(13,16)17/h1-2,8H,3-6H2,(H,14,15)(H2,13,16,17) |
| InChIKey | FNGOKIDKLFMWPF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|