C15H17N3O5S2 — CID 154845795
N-(2-hydroxyethyl)-4-[[2-(5-sulfamoylthiophen-2-yl)acetyl]amino]benzamide (PubChem CID 154845795) has the molecular formula C15H17N3O5S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-[[2-(5-sulfamoylthiophen-2-yl)acetyl]amino]benzamide.
| Compound Name | N-(2-hydroxyethyl)-4-[[2-(5-sulfamoylthiophen-2-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 154845795 |
| Molecular Formula | C15H17N3O5S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | N-(2-hydroxyethyl)-4-[[2-(5-sulfamoylthiophen-2-yl)acetyl]amino]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(=O)NCCO)cc2)s1 |
| InChI | InChI=1S/C15H17N3O5S2/c16-25(22,23)14-6-5-12(24-14)9-13(20)18-11-3-1-10(2-4-11)15(21)17-7-8-19/h1-6,19H,7-9H2,(H,17,21)(H,18,20)(H2,16,22,23) |
| InChIKey | AWRFKXROMJRWHA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |