C16H19N3O4S2 — CID 154835109
N-propyl-4-[[2-(5-sulfamoylthiophen-2-yl)acetyl]amino]benzamide (PubChem CID 154835109) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-propyl-4-[[2-(5-sulfamoylthiophen-2-yl)acetyl]amino]benzamide.
| Compound Name | N-propyl-4-[[2-(5-sulfamoylthiophen-2-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 154835109 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-propyl-4-[[2-(5-sulfamoylthiophen-2-yl)acetyl]amino]benzamide |
| SMILES | CCCNC(=O)c1ccc(NC(=O)Cc2ccc(S(N)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C16H19N3O4S2/c1-2-9-18-16(21)11-3-5-12(6-4-11)19-14(20)10-13-7-8-15(24-13)25(17,22)23/h3-8H,2,9-10H2,1H3,(H,18,21)(H,19,20)(H2,17,22,23) |
| InChIKey | TXSRNTLOFRIHJO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |