C9H11F3N2O3S2 — CID 65386753
2-(5-sulfamoylthiophen-2-yl)-N-(3,3,3-trifluoropropyl)acetamide (PubChem CID 65386753) has the molecular formula C9H11F3N2O3S2 and a molecular weight of 316.33 g/mol. Its IUPAC name is 2-(5-sulfamoylthiophen-2-yl)-N-(3,3,3-trifluoropropyl)acetamide.
| Compound Name | 2-(5-sulfamoylthiophen-2-yl)-N-(3,3,3-trifluoropropyl)acetamide |
|---|---|
| PubChem CID | 65386753 |
| Molecular Formula | C9H11F3N2O3S2 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-(5-sulfamoylthiophen-2-yl)-N-(3,3,3-trifluoropropyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)NCCC(F)(F)F)s1 |
| InChI | InChI=1S/C9H11F3N2O3S2/c10-9(11,12)3-4-14-7(15)5-6-1-2-8(18-6)19(13,16)17/h1-2H,3-5H2,(H,14,15)(H2,13,16,17) |
| InChIKey | GRPQRILRZZNTKP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |