C10H15N3O4S2 — CID 61128464
2-acetamido-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]acetamide (PubChem CID 61128464) has the molecular formula C10H15N3O4S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-acetamido-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]acetamide.
| Compound Name | 2-acetamido-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 61128464 |
| Molecular Formula | C10H15N3O4S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-acetamido-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]acetamide |
| SMILES | CC(=O)NCC(=O)NCCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C10H15N3O4S2/c1-7(14)13-6-9(15)12-5-4-8-2-3-10(18-8)19(11,16)17/h2-3H,4-6H2,1H3,(H,12,15)(H,13,14)(H2,11,16,17) |
| InChIKey | DKWNEULINLAKHV-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |