C11H14N4O3S2 — CID 60976790
2-pyrazol-1-yl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]acetamide (PubChem CID 60976790) has the molecular formula C11H14N4O3S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-pyrazol-1-yl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]acetamide.
| Compound Name | 2-pyrazol-1-yl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 60976790 |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-pyrazol-1-yl-N-[2-(5-sulfamoylthiophen-2-yl)ethyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)Cn2cccn2)s1 |
| InChI | InChI=1S/C11H14N4O3S2/c12-20(17,18)11-3-2-9(19-11)4-6-13-10(16)8-15-7-1-5-14-15/h1-3,5,7H,4,6,8H2,(H,13,16)(H2,12,17,18) |
| InChIKey | CIXIDFQGRRBKNJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |