C11H13ClN4OS — CID 114138951
2-(4-aminopyrazol-1-yl)-N-[2-(5-chlorothiophen-2-yl)ethyl]acetamide (PubChem CID 114138951) has the molecular formula C11H13ClN4OS and a molecular weight of 284.77 g/mol. Its IUPAC name is 2-(4-aminopyrazol-1-yl)-N-[2-(5-chlorothiophen-2-yl)ethyl]acetamide.
| Compound Name | 2-(4-aminopyrazol-1-yl)-N-[2-(5-chlorothiophen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 114138951 |
| Molecular Formula | C11H13ClN4OS |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-(4-aminopyrazol-1-yl)-N-[2-(5-chlorothiophen-2-yl)ethyl]acetamide |
| SMILES | Nc1cnn(CC(=O)NCCc2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C11H13ClN4OS/c12-10-2-1-9(18-10)3-4-14-11(17)7-16-6-8(13)5-15-16/h1-2,5-6H,3-4,7,13H2,(H,14,17) |
| InChIKey | LGCSQNDOOYBAOU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |