C8H13N5O3 — CID 83201957
2-[[2-(4-aminopyrazol-1-yl)acetyl]amino]ethyl carbamate (PubChem CID 83201957) has the molecular formula C8H13N5O3 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-[[2-(4-aminopyrazol-1-yl)acetyl]amino]ethyl carbamate.
| Compound Name | 2-[[2-(4-aminopyrazol-1-yl)acetyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83201957 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-[[2-(4-aminopyrazol-1-yl)acetyl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)Cn1cc(N)cn1 |
| InChI | InChI=1S/C8H13N5O3/c9-6-3-12-13(4-6)5-7(14)11-1-2-16-8(10)15/h3-4H,1-2,5,9H2,(H2,10,15)(H,11,14) |
| InChIKey | GNJCGCWBNDZGIL-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|