C13H23N5O3 — CID 114517811
tert-butyl N-[3-[[2-(4-aminopyrazol-1-yl)acetyl]amino]propyl]carbamate (PubChem CID 114517811) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(4-aminopyrazol-1-yl)acetyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-(4-aminopyrazol-1-yl)acetyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 114517811 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | tert-butyl N-[3-[[2-(4-aminopyrazol-1-yl)acetyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)Cn1cc(N)cn1 |
| InChI | InChI=1S/C13H23N5O3/c1-13(2,3)21-12(20)16-6-4-5-15-11(19)9-18-8-10(14)7-17-18/h7-8H,4-6,9,14H2,1-3H3,(H,15,19)(H,16,20) |
| InChIKey | QYSXAQJIWMWRHR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|