C13H21N3O4 — CID 162677574
1-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]pyrazole-4-carboxylic acid (PubChem CID 162677574) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 162677574 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]pyrazole-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCn1cc(C(=O)O)cn1 |
| InChI | InChI=1S/C13H21N3O4/c1-13(2,3)20-12(19)14-6-4-5-7-16-9-10(8-15-16)11(17)18/h8-9H,4-7H2,1-3H3,(H,14,19)(H,17,18) |
| InChIKey | HHCHUBUPMPFBJE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|