C20H25N5O2 — CID 170778380
tert-butyl N-[4-(4-quinoxalin-2-ylpyrazol-1-yl)butyl]carbamate (PubChem CID 170778380) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is tert-butyl N-[4-(4-quinoxalin-2-ylpyrazol-1-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-quinoxalin-2-ylpyrazol-1-yl)butyl]carbamate |
|---|---|
| PubChem CID | 170778380 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | tert-butyl N-[4-(4-quinoxalin-2-ylpyrazol-1-yl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCn1cc(-c2cnc3ccccc3n2)cn1 |
| InChI | InChI=1S/C20H25N5O2/c1-20(2,3)27-19(26)21-10-6-7-11-25-14-15(12-23-25)18-13-22-16-8-4-5-9-17(16)24-18/h4-5,8-9,12-14H,6-7,10-11H2,1-3H3,(H,21,26) |
| InChIKey | ZUGHCFBWDFSEEH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|