C20H26ClN3O6 — CID 129250706
(2R)-3-[3-chloro-4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]-2-hydroxypropanoic acid (PubChem CID 129250706) has the molecular formula C20H26ClN3O6 and a molecular weight of 439.90 g/mol. Its IUPAC name is (2R)-3-[3-chloro-4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]-2-hydroxypropanoic acid.
| Compound Name | (2R)-3-[3-chloro-4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 129250706 |
| Molecular Formula | C20H26ClN3O6 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (2R)-3-[3-chloro-4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]-2-hydroxypropanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCn1cc(-c2ccc(OC[C@@H](O)C(=O)O)cc2Cl)cn1 |
| InChI | InChI=1S/C20H26ClN3O6/c1-20(2,3)30-19(28)22-7-4-8-24-11-13(10-23-24)15-6-5-14(9-16(15)21)29-12-17(25)18(26)27/h5-6,9-11,17,25H,4,7-8,12H2,1-3H3,(H,22,28)(H,26,27)/t17-/m1/s1 |
| InChIKey | CPWZREDMCXXADU-QGZVFWFLSA-N |
| XLogP | 2.94 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|