C21H28N4O6 — CID 129250025
2-hydroxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]pyridazin-3-yl]phenoxy]propanoic acid (PubChem CID 129250025) has the molecular formula C21H28N4O6 and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-hydroxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]pyridazin-3-yl]phenoxy]propanoic acid.
| Compound Name | 2-hydroxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]pyridazin-3-yl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 129250025 |
| Molecular Formula | C21H28N4O6 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-hydroxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]pyridazin-3-yl]phenoxy]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ccc(-c2ccc(OCC(O)C(=O)O)cc2)nn1 |
| InChI | InChI=1S/C21H28N4O6/c1-21(2,3)31-20(29)23-12-4-11-22-18-10-9-16(24-25-18)14-5-7-15(8-6-14)30-13-17(26)19(27)28/h5-10,17,26H,4,11-13H2,1-3H3,(H,22,25)(H,23,29)(H,27,28) |
| InChIKey | LYAHMHGNYQEELV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|